C15H20N2O4S — CID 120526461
2-[2-[3-[3-(methylcarbamoyl)phenyl]propanoylamino]ethylsulfanyl]acetic acid (PubChem CID 120526461) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-[2-[3-[3-(methylcarbamoyl)phenyl]propanoylamino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[3-[3-(methylcarbamoyl)phenyl]propanoylamino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526461 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-[2-[3-[3-(methylcarbamoyl)phenyl]propanoylamino]ethylsulfanyl]acetic acid |
| SMILES | CNC(=O)c1cccc(CCC(=O)NCCSCC(=O)O)c1 |
| InChI | InChI=1S/C15H20N2O4S/c1-16-15(21)12-4-2-3-11(9-12)5-6-13(18)17-7-8-22-10-14(19)20/h2-4,9H,5-8,10H2,1H3,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | HKLKJMWYQDRBFE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|