C16H24N2O5S2 — CID 120526468
2-[2-[3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoylamino]ethylsulfanyl]acetic acid (PubChem CID 120526468) has the molecular formula C16H24N2O5S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[2-[3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoylamino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoylamino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526468 |
| Molecular Formula | C16H24N2O5S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[2-[3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoylamino]ethylsulfanyl]acetic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCC(=O)NCCSCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C16H24N2O5S2/c1-11-8-12(2)16(13(3)9-11)25(22,23)18-5-4-14(19)17-6-7-24-10-15(20)21/h8-9,18H,4-7,10H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | CQWLMNXAEODYGA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|