C16H13N7 — CID 12052668
3-N-isoquinolin-4-yl-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine (PubChem CID 12052668) has the molecular formula C16H13N7 and a molecular weight of 303.33 g/mol. Its IUPAC name is 3-N-isoquinolin-4-yl-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-isoquinolin-4-yl-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 12052668 |
| Molecular Formula | C16H13N7 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-N-isoquinolin-4-yl-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2cncc3ccccc23)nn1-c1ccccn1 |
| InChI | InChI=1S/C16H13N7/c17-15-21-16(22-23(15)14-7-3-4-8-19-14)20-13-10-18-9-11-5-1-2-6-12(11)13/h1-10H,(H3,17,20,21,22) |
| InChIKey | DGOILIISUUAKFU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |