C5H11N3 — CID 12052714
5-methyl-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 12052714) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 5-methyl-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | 5-methyl-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 12052714 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 5-methyl-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | CC1CN=C(N)NC1 |
| InChI | InChI=1S/C5H11N3/c1-4-2-7-5(6)8-3-4/h4H,2-3H2,1H3,(H3,6,7,8) |
| InChIKey | OFPWREAHCPFJQM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |