C15H16N2O5 — CID 120527206
5-[[(6-propan-2-yloxypyridine-2-carbonyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 120527206) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 5-[[(6-propan-2-yloxypyridine-2-carbonyl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(6-propan-2-yloxypyridine-2-carbonyl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 120527206 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 5-[[(6-propan-2-yloxypyridine-2-carbonyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | CC(C)Oc1cccc(C(=O)NCc2ccc(C(=O)O)o2)n1 |
| InChI | InChI=1S/C15H16N2O5/c1-9(2)21-13-5-3-4-11(17-13)14(18)16-8-10-6-7-12(22-10)15(19)20/h3-7,9H,8H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | HVQUWGDNLQGWRI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |