C18H20N2O3 — CID 120527980
2,2-dimethyl-3-[(2-methyl-3-pyridin-2-ylbenzoyl)amino]propanoic acid (PubChem CID 120527980) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(2-methyl-3-pyridin-2-ylbenzoyl)amino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[(2-methyl-3-pyridin-2-ylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 120527980 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2,2-dimethyl-3-[(2-methyl-3-pyridin-2-ylbenzoyl)amino]propanoic acid |
| SMILES | Cc1c(C(=O)NCC(C)(C)C(=O)O)cccc1-c1ccccn1 |
| InChI | InChI=1S/C18H20N2O3/c1-12-13(15-9-4-5-10-19-15)7-6-8-14(12)16(21)20-11-18(2,3)17(22)23/h4-10H,11H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | MZXLSGRFCAEXCE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |