C10H12N4O3S — CID 1205281
(1S,2R,5R)-2-(4-prop-2-enyl-5-sulfanylidenetetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 1205281) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is (1S,2R,5R)-2-(4-prop-2-enyl-5-sulfanylidenetetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,2R,5R)-2-(4-prop-2-enyl-5-sulfanylidenetetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 1205281 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (1S,2R,5R)-2-(4-prop-2-enyl-5-sulfanylidenetetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | C=CCn1nnn([C@@H]2CC(=O)[C@@H]3OC[C@H]2O3)c1=S |
| InChI | InChI=1S/C10H12N4O3S/c1-2-3-13-10(18)14(12-11-13)6-4-7(15)9-16-5-8(6)17-9/h2,6,8-9H,1,3-5H2/t6-,8-,9-/m1/s1 |
| InChIKey | VUHUSUXCFSBHAC-FTLITQJKSA-N |
| XLogP | 0.25 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|