C20H23NO3 — CID 120528339
3-[4-[[2-(2,4,6-trimethylphenyl)acetyl]amino]phenyl]propanoic acid (PubChem CID 120528339) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[4-[[2-(2,4,6-trimethylphenyl)acetyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[2-(2,4,6-trimethylphenyl)acetyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 120528339 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-[4-[[2-(2,4,6-trimethylphenyl)acetyl]amino]phenyl]propanoic acid |
| SMILES | Cc1cc(C)c(CC(=O)Nc2ccc(CCC(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C20H23NO3/c1-13-10-14(2)18(15(3)11-13)12-19(22)21-17-7-4-16(5-8-17)6-9-20(23)24/h4-5,7-8,10-11H,6,9,12H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | NCKKAUYAZTZCJN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |