C16H22N2O4 — CID 120528498
4-methyl-2-[[(3-prop-2-enoxypyridine-2-carbonyl)amino]methyl]pentanoic acid (PubChem CID 120528498) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-methyl-2-[[(3-prop-2-enoxypyridine-2-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 4-methyl-2-[[(3-prop-2-enoxypyridine-2-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 120528498 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-methyl-2-[[(3-prop-2-enoxypyridine-2-carbonyl)amino]methyl]pentanoic acid |
| SMILES | C=CCOc1cccnc1C(=O)NCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C16H22N2O4/c1-4-8-22-13-6-5-7-17-14(13)15(19)18-10-12(16(20)21)9-11(2)3/h4-7,11-12H,1,8-10H2,2-3H3,(H,18,19)(H,20,21) |
| InChIKey | KQHHGNDXAMHTHP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|