C17H21N3O4 — CID 120530793
4-[4-[3-(2-methylpyrazol-3-yl)propanoylamino]phenoxy]butanoic acid (PubChem CID 120530793) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-[4-[3-(2-methylpyrazol-3-yl)propanoylamino]phenoxy]butanoic acid.
| Compound Name | 4-[4-[3-(2-methylpyrazol-3-yl)propanoylamino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 120530793 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-[4-[3-(2-methylpyrazol-3-yl)propanoylamino]phenoxy]butanoic acid |
| SMILES | Cn1nccc1CCC(=O)Nc1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C17H21N3O4/c1-20-14(10-11-18-20)6-9-16(21)19-13-4-7-15(8-5-13)24-12-2-3-17(22)23/h4-5,7-8,10-11H,2-3,6,9,12H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | FOSFBSGBIZADBH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|