C20H25NO5 — CID 120532205
4-methoxy-3-methyl-3-[[5-(3-propan-2-ylphenyl)furan-2-carbonyl]amino]butanoic acid (PubChem CID 120532205) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 4-methoxy-3-methyl-3-[[5-(3-propan-2-ylphenyl)furan-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-methoxy-3-methyl-3-[[5-(3-propan-2-ylphenyl)furan-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120532205 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-methoxy-3-methyl-3-[[5-(3-propan-2-ylphenyl)furan-2-carbonyl]amino]butanoic acid |
| SMILES | COCC(C)(CC(=O)O)NC(=O)c1ccc(-c2cccc(C(C)C)c2)o1 |
| InChI | InChI=1S/C20H25NO5/c1-13(2)14-6-5-7-15(10-14)16-8-9-17(26-16)19(24)21-20(3,12-25-4)11-18(22)23/h5-10,13H,11-12H2,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | UFDJHULWIMWLBE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |