C19H18F3NO5 — CID 120533135
2-[(2-methoxyphenyl)methyl]-3-[[3-(trifluoromethoxy)benzoyl]amino]propanoic acid (PubChem CID 120533135) has the molecular formula C19H18F3NO5 and a molecular weight of 397.35 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methyl]-3-[[3-(trifluoromethoxy)benzoyl]amino]propanoic acid.
| Compound Name | 2-[(2-methoxyphenyl)methyl]-3-[[3-(trifluoromethoxy)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 120533135 |
| Molecular Formula | C19H18F3NO5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[(2-methoxyphenyl)methyl]-3-[[3-(trifluoromethoxy)benzoyl]amino]propanoic acid |
| SMILES | COc1ccccc1CC(CNC(=O)c1cccc(OC(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C19H18F3NO5/c1-27-16-8-3-2-5-12(16)9-14(18(25)26)11-23-17(24)13-6-4-7-15(10-13)28-19(20,21)22/h2-8,10,14H,9,11H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | VVUFZLSUNXZCEK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |