About 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid
2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid (PubChem CID 120533256) has the molecular formula C14H21N3O5
and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid |
| PubChem CID | 120533256 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNC(=O)c1c(OC)ncnc1OC)C(=O)O |
| InChI | InChI=1S/C14H21N3O5/c1-5-14(6-2,13(19)20)7-15-10(18)9-11(21-3)16-8-17-12(9)22-4/h8H,5-7H2,1-4H3,(H,15,18)(H,19,20) |
| InChIKey | YOCVOBYHBWVTMY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid?
The IUPAC name of 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid (CID 120533256) is 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid.
What is the SMILES notation for 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid?
The canonical SMILES for 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid is CCC(CC)(CNC(=O)c1c(OC)ncnc1OC)C(=O)O.
What is the InChIKey of 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid?
The InChIKey is YOCVOBYHBWVTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O5/c1-5-14(6-2,13(19)20)7-15-10(18)9-11(21-3)16-8-17-12(9)22-4/h8H,5-7H2,1-4H3,(H,15,18)(H,19,20).
What are the key properties of 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid?
2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid has a molecular weight of 311.34 g/mol, XLogP of 1.11, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4,6-dimethoxypyrimidine-5-carbonyl)amino]methyl]-2-ethylbutanoic acid is sourced from PubChem (CID 120533256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).