C16H19N3O6 — CID 120533899
1-(2-morpholin-4-yl-3-nitrobenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 120533899) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-3-nitrobenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-morpholin-4-yl-3-nitrobenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120533899 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-(2-morpholin-4-yl-3-nitrobenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2cccc([N+](=O)[O-])c2N2CCOCC2)C1 |
| InChI | InChI=1S/C16H19N3O6/c20-15(18-5-4-11(10-18)16(21)22)12-2-1-3-13(19(23)24)14(12)17-6-8-25-9-7-17/h1-3,11H,4-10H2,(H,21,22) |
| InChIKey | ZGKGBWRYBPSDOJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|