C16H20N2O5 — CID 120535828
3-cyclopropyl-2-[[2-[(2-phenoxyacetyl)amino]acetyl]amino]propanoic acid (PubChem CID 120535828) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is 3-cyclopropyl-2-[[2-[(2-phenoxyacetyl)amino]acetyl]amino]propanoic acid.
| Compound Name | 3-cyclopropyl-2-[[2-[(2-phenoxyacetyl)amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 120535828 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-cyclopropyl-2-[[2-[(2-phenoxyacetyl)amino]acetyl]amino]propanoic acid |
| SMILES | O=C(COc1ccccc1)NCC(=O)NC(CC1CC1)C(=O)O |
| InChI | InChI=1S/C16H20N2O5/c19-14(18-13(16(21)22)8-11-6-7-11)9-17-15(20)10-23-12-4-2-1-3-5-12/h1-5,11,13H,6-10H2,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | WXGWBIATZKOVBN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |