C14H15ClN2O6 — CID 120536229
(6R)-4-[2-(2-chloro-4-nitrophenyl)acetyl]-6-methylmorpholine-2-carboxylic acid (PubChem CID 120536229) has the molecular formula C14H15ClN2O6 and a molecular weight of 342.74 g/mol. Its IUPAC name is (6R)-4-[2-(2-chloro-4-nitrophenyl)acetyl]-6-methylmorpholine-2-carboxylic acid.
| Compound Name | (6R)-4-[2-(2-chloro-4-nitrophenyl)acetyl]-6-methylmorpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 120536229 |
| Molecular Formula | C14H15ClN2O6 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (6R)-4-[2-(2-chloro-4-nitrophenyl)acetyl]-6-methylmorpholine-2-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)Cc2ccc([N+](=O)[O-])cc2Cl)CC(C(=O)O)O1 |
| InChI | InChI=1S/C14H15ClN2O6/c1-8-6-16(7-12(23-8)14(19)20)13(18)4-9-2-3-10(17(21)22)5-11(9)15/h2-3,5,8,12H,4,6-7H2,1H3,(H,19,20)/t8-,12?/m1/s1 |
| InChIKey | ANWFLKLNWPBFOR-SZSXPDSJSA-N |
| XLogP | 1.49 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|