C16H20N2O4 — CID 120537179
4-[[2-(4-methoxy-1H-indol-3-yl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 120537179) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-[[2-(4-methoxy-1H-indol-3-yl)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 4-[[2-(4-methoxy-1H-indol-3-yl)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120537179 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4-[[2-(4-methoxy-1H-indol-3-yl)acetyl]amino]-3-methylbutanoic acid |
| SMILES | COc1cccc2[nH]cc(CC(=O)NCC(C)CC(=O)O)c12 |
| InChI | InChI=1S/C16H20N2O4/c1-10(6-15(20)21)8-18-14(19)7-11-9-17-12-4-3-5-13(22-2)16(11)12/h3-5,9-10,17H,6-8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | QWXFIULBXFEFEO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |