2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid

C16H19NO3 — CID 120537806

IUPAC2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid
SMILESO=C(O)Cc1ccc(NC(=O)C(C2CC2)C2CC2)cc1
InChIInChI=1S/C16H19NO3/c18-14(19)9-10-1-7-13(8-2-10)17-16(20)15(11-3-4-11)12-5-6-12/h1-2,7-8,11-12,15H,3-6,9H2,(H,17,20)(H,18,19)
InChIKeyQPFVLFNSNBGGOK-UHFFFAOYSA-N
MW273.33 g/mol
LogP2.69
Rot. Bonds6

About 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid

2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid (PubChem CID 120537806) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid.

Molecular Properties

Compound Name2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid
PubChem CID120537806
Molecular FormulaC16H19NO3
Molecular Weight273.33 g/mol
Exact Mass273.14
IUPAC Name2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid
SMILESO=C(O)Cc1ccc(NC(=O)C(C2CC2)C2CC2)cc1
InChIInChI=1S/C16H19NO3/c18-14(19)9-10-1-7-13(8-2-10)17-16(20)15(11-3-4-11)12-5-6-12/h1-2,7-8,11-12,15H,3-6,9H2,(H,17,20)(H,18,19)
InChIKeyQPFVLFNSNBGGOK-UHFFFAOYSA-N
XLogP2.69
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.33
LogP ≤ 52.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid?
The IUPAC name of 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid (CID 120537806) is 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid.
What is the SMILES notation for 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid?
The canonical SMILES for 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid is O=C(O)Cc1ccc(NC(=O)C(C2CC2)C2CC2)cc1.
What is the InChIKey of 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid?
The InChIKey is QPFVLFNSNBGGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c18-14(19)9-10-1-7-13(8-2-10)17-16(20)15(11-3-4-11)12-5-6-12/h1-2,7-8,11-12,15H,3-6,9H2,(H,17,20)(H,18,19).
What are the key properties of 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid?
2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid has a molecular weight of 273.33 g/mol, XLogP of 2.69, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2,2-dicyclopropylacetyl)amino]phenyl]acetic acid is sourced from PubChem (CID 120537806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).