C21H24N2O5 — CID 120539605
1-[[3-(furan-2-carbonylamino)-4-methylbenzoyl]-methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120539605) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[[3-(furan-2-carbonylamino)-4-methylbenzoyl]-methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[3-(furan-2-carbonylamino)-4-methylbenzoyl]-methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120539605 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[[3-(furan-2-carbonylamino)-4-methylbenzoyl]-methylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)N(C)C2(C(=O)O)CCCCC2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H24N2O5/c1-14-8-9-15(13-16(14)22-18(24)17-7-6-12-28-17)19(25)23(2)21(20(26)27)10-4-3-5-11-21/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,22,24)(H,26,27) |
| InChIKey | SJRJZOVVCIKYCB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |