C19H18F3NO4 — CID 120540878
2-methyl-3-[4-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]phenyl]propanoic acid (PubChem CID 120540878) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2-methyl-3-[4-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]phenyl]propanoic acid.
| Compound Name | 2-methyl-3-[4-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 120540878 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-methyl-3-[4-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]phenyl]propanoic acid |
| SMILES | CC(Cc1ccc(NC(=O)Cc2ccc(OC(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C19H18F3NO4/c1-12(18(25)26)10-13-2-6-15(7-3-13)23-17(24)11-14-4-8-16(9-5-14)27-19(20,21)22/h2-9,12H,10-11H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | AUIISQBXSKTRCL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |