C17H21NO6 — CID 120541544
4-[[[2-(3-acetylphenoxy)acetyl]amino]methyl]oxane-4-carboxylic acid (PubChem CID 120541544) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-[[[2-(3-acetylphenoxy)acetyl]amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[[2-(3-acetylphenoxy)acetyl]amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120541544 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[[[2-(3-acetylphenoxy)acetyl]amino]methyl]oxane-4-carboxylic acid |
| SMILES | CC(=O)c1cccc(OCC(=O)NCC2(C(=O)O)CCOCC2)c1 |
| InChI | InChI=1S/C17H21NO6/c1-12(19)13-3-2-4-14(9-13)24-10-15(20)18-11-17(16(21)22)5-7-23-8-6-17/h2-4,9H,5-8,10-11H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | RIHHTLVGCKZOJZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |