C17H28N2O5 — CID 120542126
4-[[(1-butanoylpiperidine-2-carbonyl)amino]methyl]oxane-4-carboxylic acid (PubChem CID 120542126) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-[[(1-butanoylpiperidine-2-carbonyl)amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(1-butanoylpiperidine-2-carbonyl)amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120542126 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 4-[[(1-butanoylpiperidine-2-carbonyl)amino]methyl]oxane-4-carboxylic acid |
| SMILES | CCCC(=O)N1CCCCC1C(=O)NCC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C17H28N2O5/c1-2-5-14(20)19-9-4-3-6-13(19)15(21)18-12-17(16(22)23)7-10-24-11-8-17/h13H,2-12H2,1H3,(H,18,21)(H,22,23) |
| InChIKey | GQZQBUJURMMYAA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |