C21H23NO4S — CID 120542234
4-[[(4-methyl-2-phenylsulfanylbenzoyl)amino]methyl]oxane-4-carboxylic acid (PubChem CID 120542234) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-[[(4-methyl-2-phenylsulfanylbenzoyl)amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(4-methyl-2-phenylsulfanylbenzoyl)amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120542234 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-[[(4-methyl-2-phenylsulfanylbenzoyl)amino]methyl]oxane-4-carboxylic acid |
| SMILES | Cc1ccc(C(=O)NCC2(C(=O)O)CCOCC2)c(Sc2ccccc2)c1 |
| InChI | InChI=1S/C21H23NO4S/c1-15-7-8-17(18(13-15)27-16-5-3-2-4-6-16)19(23)22-14-21(20(24)25)9-11-26-12-10-21/h2-8,13H,9-12,14H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | MKKWIXZHNYSKFD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |