C16H23N3O4 — CID 120543379
4-[[(1-cyclopentylpyrazole-3-carbonyl)amino]methyl]oxane-4-carboxylic acid (PubChem CID 120543379) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[[(1-cyclopentylpyrazole-3-carbonyl)amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(1-cyclopentylpyrazole-3-carbonyl)amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120543379 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-[[(1-cyclopentylpyrazole-3-carbonyl)amino]methyl]oxane-4-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCOCC1)c1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C16H23N3O4/c20-14(13-5-8-19(18-13)12-3-1-2-4-12)17-11-16(15(21)22)6-9-23-10-7-16/h5,8,12H,1-4,6-7,9-11H2,(H,17,20)(H,21,22) |
| InChIKey | ZHOBBIUXOMEUJL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |