C22H26N2O4 — CID 120545686
2-methyl-2-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 120545686) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-methyl-2-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-methyl-2-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120545686 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-methyl-2-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CC1(NC(=O)CNC(=O)Cc2cccc3ccccc23)CCCCC1C(=O)O |
| InChI | InChI=1S/C22H26N2O4/c1-22(12-5-4-11-18(22)21(27)28)24-20(26)14-23-19(25)13-16-9-6-8-15-7-2-3-10-17(15)16/h2-3,6-10,18H,4-5,11-14H2,1H3,(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | YZYMNSFQUBVLEX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |