C20H25N3O3 — CID 120546076
2-[(1-benzyl-5-methylpyrazole-4-carbonyl)amino]-2-methylcyclohexane-1-carboxylic acid (PubChem CID 120546076) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[(1-benzyl-5-methylpyrazole-4-carbonyl)amino]-2-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(1-benzyl-5-methylpyrazole-4-carbonyl)amino]-2-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120546076 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[(1-benzyl-5-methylpyrazole-4-carbonyl)amino]-2-methylcyclohexane-1-carboxylic acid |
| SMILES | Cc1c(C(=O)NC2(C)CCCCC2C(=O)O)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C20H25N3O3/c1-14-16(12-21-23(14)13-15-8-4-3-5-9-15)18(24)22-20(2)11-7-6-10-17(20)19(25)26/h3-5,8-9,12,17H,6-7,10-11,13H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | AVOKECSVYCZXDE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |