C22H23N3O4 — CID 120546558
4-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]-5-phenylpentanoic acid (PubChem CID 120546558) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120546558 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-[[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]amino]-5-phenylpentanoic acid |
| SMILES | Cn1nc(CC(=O)NC(CCC(=O)O)Cc2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H23N3O4/c1-25-22(29)18-10-6-5-9-17(18)19(24-25)14-20(26)23-16(11-12-21(27)28)13-15-7-3-2-4-8-15/h2-10,16H,11-14H2,1H3,(H,23,26)(H,27,28) |
| InChIKey | FBIKHZZOFKTDHV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |