C18H25NO6 — CID 120547637
2-[(3,4-diethoxybenzoyl)amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120547637) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[(3,4-diethoxybenzoyl)amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[(3,4-diethoxybenzoyl)amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120547637 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[(3,4-diethoxybenzoyl)amino]-2-(oxan-3-yl)acetic acid |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)O)C2CCCOC2)cc1OCC |
| InChI | InChI=1S/C18H25NO6/c1-3-24-14-8-7-12(10-15(14)25-4-2)17(20)19-16(18(21)22)13-6-5-9-23-11-13/h7-8,10,13,16H,3-6,9,11H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | KFZDBBXPASVZNU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |