About 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid
2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 120551878) has the molecular formula C14H20N4O4S
and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid |
| PubChem CID | 120551878 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | Cc1cc(N2CCCC(NC(=O)CSCC(=O)O)C2=O)n(C)n1 |
| InChI | InChI=1S/C14H20N4O4S/c1-9-6-12(17(2)16-9)18-5-3-4-10(14(18)22)15-11(19)7-23-8-13(20)21/h6,10H,3-5,7-8H2,1-2H3,(H,15,19)(H,20,21) |
| InChIKey | RDNCHSNANZTYKL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid?
The IUPAC name of 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid (CID 120551878) is 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid.
What is the SMILES notation for 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid?
The canonical SMILES for 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid is Cc1cc(N2CCCC(NC(=O)CSCC(=O)O)C2=O)n(C)n1.
What is the InChIKey of 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid?
The InChIKey is RDNCHSNANZTYKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O4S/c1-9-6-12(17(2)16-9)18-5-3-4-10(14(18)22)15-11(19)7-23-8-13(20)21/h6,10H,3-5,7-8H2,1-2H3,(H,15,19)(H,20,21).
What are the key properties of 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid?
2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid has a molecular weight of 340.41 g/mol, XLogP of 0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]sulfanylacetic acid is sourced from PubChem (CID 120551878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).