C18H18B2N2O5 — CID 12055267
2,13,15,26,27-pentaoxa-10,23-diaza-1,14-diboratetracyclo[12.12.1.03,8.016,21]heptacosa-3,5,7,9,16,18,20,22-octaene (PubChem CID 12055267) has the molecular formula C18H18B2N2O5 and a molecular weight of 363.98 g/mol. Its IUPAC name is 2,13,15,26,27-pentaoxa-10,23-diaza-1,14-diboratetracyclo[12.12.1.03,8.016,21]heptacosa-3,5,7,9,16,18,20,22-octaene.
| Compound Name | 2,13,15,26,27-pentaoxa-10,23-diaza-1,14-diboratetracyclo[12.12.1.03,8.016,21]heptacosa-3,5,7,9,16,18,20,22-octaene |
|---|---|
| PubChem CID | 12055267 |
| Molecular Formula | C18H18B2N2O5 |
| Molecular Weight | 363.98 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2,13,15,26,27-pentaoxa-10,23-diaza-1,14-diboratetracyclo[12.12.1.03,8.016,21]heptacosa-3,5,7,9,16,18,20,22-octaene |
| SMILES | C1=N/CCOB2OB(OCC/N=C/c3ccccc3O2)Oc2ccccc2/1 |
| InChI | InChI=1S/C18H18B2N2O5/c1-3-7-17-15(5-1)13-21-9-11-24-20-26-18-8-4-2-6-16(18)14-22-10-12-23-19(25-17)27-20/h1-8,13-14H,9-12H2/b21-13+,22-14+ |
| InChIKey | WELAFTQFHHUKCQ-JFMUQQRKSA-N |
| XLogP | 2.03 |
| TPSA | 70.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.98 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|