C19H20N2O3S — CID 120552827
6-[2-[(E)-2-thiophen-2-ylethenyl]azepane-1-carbonyl]pyridine-2-carboxylic acid (PubChem CID 120552827) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 6-[2-[(E)-2-thiophen-2-ylethenyl]azepane-1-carbonyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[2-[(E)-2-thiophen-2-ylethenyl]azepane-1-carbonyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 120552827 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 6-[2-[(E)-2-thiophen-2-ylethenyl]azepane-1-carbonyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C(=O)N2CCCCCC2/C=C/c2cccs2)n1 |
| InChI | InChI=1S/C19H20N2O3S/c22-18(16-8-4-9-17(20-16)19(23)24)21-12-3-1-2-6-14(21)10-11-15-7-5-13-25-15/h4-5,7-11,13-14H,1-3,6,12H2,(H,23,24)/b11-10+ |
| InChIKey | YGFSGLSFZJIVAW-ZHACJKMWSA-N |
| XLogP | 3.94 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |