C18H29ClN2O2 — CID 120553316
4-(3-methylbutoxy)-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride (PubChem CID 120553316) has the molecular formula C18H29ClN2O2 and a molecular weight of 340.90 g/mol. Its IUPAC name is 4-(3-methylbutoxy)-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride.
| Compound Name | 4-(3-methylbutoxy)-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120553316 |
| Molecular Formula | C18H29ClN2O2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-(3-methylbutoxy)-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride |
| SMILES | CC(C)CCOc1ccc(C(=O)NC2CCNCC2C)cc1.Cl |
| InChI | InChI=1S/C18H28N2O2.ClH/c1-13(2)9-11-22-16-6-4-15(5-7-16)18(21)20-17-8-10-19-12-14(17)3;/h4-7,13-14,17,19H,8-12H2,1-3H3,(H,20,21);1H |
| InChIKey | GJQPQWCVPIYILP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |