C21H25ClN2OS — CID 120553350
2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-(3-methylpiperidin-4-yl)acetamide (PubChem CID 120553350) has the molecular formula C21H25ClN2OS and a molecular weight of 388.96 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-(3-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-(3-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 120553350 |
| Molecular Formula | C21H25ClN2OS |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-(3-methylpiperidin-4-yl)acetamide |
| SMILES | CC1CNCCC1NC(=O)CSC(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2OS/c1-15-13-23-12-11-19(15)24-20(25)14-26-21(16-5-3-2-4-6-16)17-7-9-18(22)10-8-17/h2-10,15,19,21,23H,11-14H2,1H3,(H,24,25) |
| InChIKey | GBBSIJDPWQTSNF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |