C14H25ClN2O — CID 120553440
N-(3-methylpiperidin-4-yl)-2-prop-2-enylpent-4-enamide;hydrochloride (PubChem CID 120553440) has the molecular formula C14H25ClN2O and a molecular weight of 272.82 g/mol. Its IUPAC name is N-(3-methylpiperidin-4-yl)-2-prop-2-enylpent-4-enamide;hydrochloride.
| Compound Name | N-(3-methylpiperidin-4-yl)-2-prop-2-enylpent-4-enamide;hydrochloride |
|---|---|
| PubChem CID | 120553440 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-(3-methylpiperidin-4-yl)-2-prop-2-enylpent-4-enamide;hydrochloride |
| SMILES | C=CCC(CC=C)C(=O)NC1CCNCC1C.Cl |
| InChI | InChI=1S/C14H24N2O.ClH/c1-4-6-12(7-5-2)14(17)16-13-8-9-15-10-11(13)3;/h4-5,11-13,15H,1-2,6-10H2,3H3,(H,16,17);1H |
| InChIKey | KATJRUUERADNHA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|