C12H21ClN4O — CID 120554197
5-ethyl-N-(3-methylpiperidin-4-yl)-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 120554197) has the molecular formula C12H21ClN4O and a molecular weight of 272.78 g/mol. Its IUPAC name is 5-ethyl-N-(3-methylpiperidin-4-yl)-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | 5-ethyl-N-(3-methylpiperidin-4-yl)-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120554197 |
| Molecular Formula | C12H21ClN4O |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5-ethyl-N-(3-methylpiperidin-4-yl)-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CCc1cc(C(=O)NC2CCNCC2C)n[nH]1.Cl |
| InChI | InChI=1S/C12H20N4O.ClH/c1-3-9-6-11(16-15-9)12(17)14-10-4-5-13-7-8(10)2;/h6,8,10,13H,3-5,7H2,1-2H3,(H,14,17)(H,15,16);1H |
| InChIKey | RBGAIRFMWRTVRH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |