C19H22ClN3O3S — CID 120554982
N-(3-methylpiperidin-4-yl)-5-nitro-2-phenylsulfanylbenzamide;hydrochloride (PubChem CID 120554982) has the molecular formula C19H22ClN3O3S and a molecular weight of 407.92 g/mol. Its IUPAC name is N-(3-methylpiperidin-4-yl)-5-nitro-2-phenylsulfanylbenzamide;hydrochloride.
| Compound Name | N-(3-methylpiperidin-4-yl)-5-nitro-2-phenylsulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120554982 |
| Molecular Formula | C19H22ClN3O3S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-(3-methylpiperidin-4-yl)-5-nitro-2-phenylsulfanylbenzamide;hydrochloride |
| SMILES | CC1CNCCC1NC(=O)c1cc([N+](=O)[O-])ccc1Sc1ccccc1.Cl |
| InChI | InChI=1S/C19H21N3O3S.ClH/c1-13-12-20-10-9-17(13)21-19(23)16-11-14(22(24)25)7-8-18(16)26-15-5-3-2-4-6-15;/h2-8,11,13,17,20H,9-10,12H2,1H3,(H,21,23);1H |
| InChIKey | NEPSEPYYFDAWSU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|