C19H27FN2O — CID 120556704
1-(3-fluorophenyl)-N-(3-methylpiperidin-4-yl)cyclohexane-1-carboxamide (PubChem CID 120556704) has the molecular formula C19H27FN2O and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-(3-methylpiperidin-4-yl)cyclohexane-1-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-(3-methylpiperidin-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 120556704 |
| Molecular Formula | C19H27FN2O |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-(3-fluorophenyl)-N-(3-methylpiperidin-4-yl)cyclohexane-1-carboxamide |
| SMILES | CC1CNCCC1NC(=O)C1(c2cccc(F)c2)CCCCC1 |
| InChI | InChI=1S/C19H27FN2O/c1-14-13-21-11-8-17(14)22-18(23)19(9-3-2-4-10-19)15-6-5-7-16(20)12-15/h5-7,12,14,17,21H,2-4,8-11,13H2,1H3,(H,22,23) |
| InChIKey | PHGQJPGHDMQSES-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |