C17H20Cl2N2OS — CID 120557411
5-(4-chlorophenyl)-N-(3-methylpiperidin-4-yl)thiophene-2-carboxamide;hydrochloride (PubChem CID 120557411) has the molecular formula C17H20Cl2N2OS and a molecular weight of 371.33 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(3-methylpiperidin-4-yl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | 5-(4-chlorophenyl)-N-(3-methylpiperidin-4-yl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120557411 |
| Molecular Formula | C17H20Cl2N2OS |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(3-methylpiperidin-4-yl)thiophene-2-carboxamide;hydrochloride |
| SMILES | CC1CNCCC1NC(=O)c1ccc(-c2ccc(Cl)cc2)s1.Cl |
| InChI | InChI=1S/C17H19ClN2OS.ClH/c1-11-10-19-9-8-14(11)20-17(21)16-7-6-15(22-16)12-2-4-13(18)5-3-12;/h2-7,11,14,19H,8-10H2,1H3,(H,20,21);1H |
| InChIKey | CSKBOKGJMFEGCE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |