About 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride
4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride (PubChem CID 120558206) has the molecular formula C15H17ClF2N2S
and a molecular weight of 330.83 g/mol. Its IUPAC name is 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride |
| PubChem CID | 120558206 |
| Molecular Formula | C15H17ClF2N2S |
| Molecular Weight | 330.83 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride |
| SMILES | Cc1cc(F)c(-c2csc(C3CCNCC3)n2)cc1F.Cl |
| InChI | InChI=1S/C15H16F2N2S.ClH/c1-9-6-13(17)11(7-12(9)16)14-8-20-15(19-14)10-2-4-18-5-3-10;/h6-8,10,18H,2-5H2,1H3;1H |
| InChIKey | AQCXDMWVTIUIHY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.83 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride?
The IUPAC name of 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride (CID 120558206) is 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride.
What is the SMILES notation for 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride?
The canonical SMILES for 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride is Cc1cc(F)c(-c2csc(C3CCNCC3)n2)cc1F.Cl.
What is the InChIKey of 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride?
The InChIKey is AQCXDMWVTIUIHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N2S.ClH/c1-9-6-13(17)11(7-12(9)16)14-8-20-15(19-14)10-2-4-18-5-3-10;/h6-8,10,18H,2-5H2,1H3;1H.
What are the key properties of 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride?
4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride has a molecular weight of 330.83 g/mol, XLogP of 4.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-difluoro-4-methylphenyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride is sourced from PubChem (CID 120558206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).