About 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride
4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride (PubChem CID 120558544) has the molecular formula C13H17ClN2S
and a molecular weight of 268.81 g/mol. Its IUPAC name is 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride.
Molecular Properties
| Compound Name | 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride |
| PubChem CID | 120558544 |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride |
| SMILES | CCc1nc(Cc2ccc(N)cc2)sc1C.Cl |
| InChI | InChI=1S/C13H16N2S.ClH/c1-3-12-9(2)16-13(15-12)8-10-4-6-11(14)7-5-10;/h4-7H,3,8,14H2,1-2H3;1H |
| InChIKey | HYIDMDNOAIYQBA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride?
The IUPAC name of 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride (CID 120558544) is 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride.
What is the SMILES notation for 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride?
The canonical SMILES for 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride is CCc1nc(Cc2ccc(N)cc2)sc1C.Cl.
What is the InChIKey of 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride?
The InChIKey is HYIDMDNOAIYQBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S.ClH/c1-3-12-9(2)16-13(15-12)8-10-4-6-11(14)7-5-10;/h4-7H,3,8,14H2,1-2H3;1H.
What are the key properties of 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride?
4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride has a molecular weight of 268.81 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)methyl]aniline;hydrochloride is sourced from PubChem (CID 120558544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).