C17H19N3O2S — CID 120559538
4-amino-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]pentanamide (PubChem CID 120559538) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 4-amino-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]pentanamide.
| Compound Name | 4-amino-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 120559538 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-amino-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]pentanamide |
| SMILES | CC(N)CCC(=O)NCc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C17H19N3O2S/c1-11(18)6-9-16(21)19-10-12-7-8-14(22-12)17-20-13-4-2-3-5-15(13)23-17/h2-5,7-8,11H,6,9-10,18H2,1H3,(H,19,21) |
| InChIKey | ISOGJVSWUOIDJV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |