C18H28ClFN2O — CID 120561267
4-amino-N-[[1-(4-fluorophenyl)cyclohexyl]methyl]pentanamide;hydrochloride (PubChem CID 120561267) has the molecular formula C18H28ClFN2O and a molecular weight of 342.89 g/mol. Its IUPAC name is 4-amino-N-[[1-(4-fluorophenyl)cyclohexyl]methyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[[1-(4-fluorophenyl)cyclohexyl]methyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120561267 |
| Molecular Formula | C18H28ClFN2O |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-amino-N-[[1-(4-fluorophenyl)cyclohexyl]methyl]pentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)NCC1(c2ccc(F)cc2)CCCCC1.Cl |
| InChI | InChI=1S/C18H27FN2O.ClH/c1-14(20)5-10-17(22)21-13-18(11-3-2-4-12-18)15-6-8-16(19)9-7-15;/h6-9,14H,2-5,10-13,20H2,1H3,(H,21,22);1H |
| InChIKey | JQCQUVDENNEXNL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |