C19H24ClFN2O3 — CID 120561352
4-amino-N-[5-fluoro-2-(2-methoxy-4-methylphenoxy)phenyl]pentanamide;hydrochloride (PubChem CID 120561352) has the molecular formula C19H24ClFN2O3 and a molecular weight of 382.86 g/mol. Its IUPAC name is 4-amino-N-[5-fluoro-2-(2-methoxy-4-methylphenoxy)phenyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[5-fluoro-2-(2-methoxy-4-methylphenoxy)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120561352 |
| Molecular Formula | C19H24ClFN2O3 |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 4-amino-N-[5-fluoro-2-(2-methoxy-4-methylphenoxy)phenyl]pentanamide;hydrochloride |
| SMILES | COc1cc(C)ccc1Oc1ccc(F)cc1NC(=O)CCC(C)N.Cl |
| InChI | InChI=1S/C19H23FN2O3.ClH/c1-12-4-7-17(18(10-12)24-3)25-16-8-6-14(20)11-15(16)22-19(23)9-5-13(2)21;/h4,6-8,10-11,13H,5,9,21H2,1-3H3,(H,22,23);1H |
| InChIKey | LYSZBVGUTXKZMJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |