C12H18Cl2N2OS — CID 120562198
4-amino-N-(3-chloro-4-methylsulfanylphenyl)pentanamide;hydrochloride (PubChem CID 120562198) has the molecular formula C12H18Cl2N2OS and a molecular weight of 309.26 g/mol. Its IUPAC name is 4-amino-N-(3-chloro-4-methylsulfanylphenyl)pentanamide;hydrochloride.
| Compound Name | 4-amino-N-(3-chloro-4-methylsulfanylphenyl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120562198 |
| Molecular Formula | C12H18Cl2N2OS |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-amino-N-(3-chloro-4-methylsulfanylphenyl)pentanamide;hydrochloride |
| SMILES | CSc1ccc(NC(=O)CCC(C)N)cc1Cl.Cl |
| InChI | InChI=1S/C12H17ClN2OS.ClH/c1-8(14)3-6-12(16)15-9-4-5-11(17-2)10(13)7-9;/h4-5,7-8H,3,6,14H2,1-2H3,(H,15,16);1H |
| InChIKey | AULKLSUJYSPNHZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |