C14H22ClN3O2 — CID 120562616
4-amino-N-(2-amino-2-oxoethyl)-N-benzylpentanamide;hydrochloride (PubChem CID 120562616) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 4-amino-N-(2-amino-2-oxoethyl)-N-benzylpentanamide;hydrochloride.
| Compound Name | 4-amino-N-(2-amino-2-oxoethyl)-N-benzylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 120562616 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-amino-N-(2-amino-2-oxoethyl)-N-benzylpentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)N(CC(N)=O)Cc1ccccc1.Cl |
| InChI | InChI=1S/C14H21N3O2.ClH/c1-11(15)7-8-14(19)17(10-13(16)18)9-12-5-3-2-4-6-12;/h2-6,11H,7-10,15H2,1H3,(H2,16,18);1H |
| InChIKey | MNCTVJGUXDEBFH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |