C11H23ClN2O3 — CID 120562971
4-amino-1-[2-(methoxymethyl)morpholin-4-yl]pentan-1-one;hydrochloride (PubChem CID 120562971) has the molecular formula C11H23ClN2O3 and a molecular weight of 266.77 g/mol. Its IUPAC name is 4-amino-1-[2-(methoxymethyl)morpholin-4-yl]pentan-1-one;hydrochloride.
| Compound Name | 4-amino-1-[2-(methoxymethyl)morpholin-4-yl]pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120562971 |
| Molecular Formula | C11H23ClN2O3 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-amino-1-[2-(methoxymethyl)morpholin-4-yl]pentan-1-one;hydrochloride |
| SMILES | COCC1CN(C(=O)CCC(C)N)CCO1.Cl |
| InChI | InChI=1S/C11H22N2O3.ClH/c1-9(12)3-4-11(14)13-5-6-16-10(7-13)8-15-2;/h9-10H,3-8,12H2,1-2H3;1H |
| InChIKey | SEYIAOOSLMRKCF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |