C19H33Cl2N3O — CID 120564537
4-amino-N-[[2-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]pentanamide;dihydrochloride (PubChem CID 120564537) has the molecular formula C19H33Cl2N3O and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-amino-N-[[2-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[[2-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120564537 |
| Molecular Formula | C19H33Cl2N3O |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-amino-N-[[2-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCc1ccccc1CN1CCCCC1C.Cl.Cl |
| InChI | InChI=1S/C19H31N3O.2ClH/c1-15(20)10-11-19(23)21-13-17-8-3-4-9-18(17)14-22-12-6-5-7-16(22)2;;/h3-4,8-9,15-16H,5-7,10-14,20H2,1-2H3,(H,21,23);2*1H |
| InChIKey | ZITSGPQPSLNHGI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |