C14H21Cl2N5O — CID 120564578
4-amino-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]pentanamide;dihydrochloride (PubChem CID 120564578) has the molecular formula C14H21Cl2N5O and a molecular weight of 346.26 g/mol. Its IUPAC name is 4-amino-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120564578 |
| Molecular Formula | C14H21Cl2N5O |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-amino-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCc1ccnc(-n2cccn2)c1.Cl.Cl |
| InChI | InChI=1S/C14H19N5O.2ClH/c1-11(15)3-4-14(20)17-10-12-5-7-16-13(9-12)19-8-2-6-18-19;;/h2,5-9,11H,3-4,10,15H2,1H3,(H,17,20);2*1H |
| InChIKey | XZPYSXQQNRKBKY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |