C14H31Cl2N3O — CID 120564985
4-amino-N-[1-(3-methylpiperidin-1-yl)propan-2-yl]pentanamide;dihydrochloride (PubChem CID 120564985) has the molecular formula C14H31Cl2N3O and a molecular weight of 328.33 g/mol. Its IUPAC name is 4-amino-N-[1-(3-methylpiperidin-1-yl)propan-2-yl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[1-(3-methylpiperidin-1-yl)propan-2-yl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120564985 |
| Molecular Formula | C14H31Cl2N3O |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 4-amino-N-[1-(3-methylpiperidin-1-yl)propan-2-yl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NC(C)CN1CCCC(C)C1.Cl.Cl |
| InChI | InChI=1S/C14H29N3O.2ClH/c1-11-5-4-8-17(9-11)10-13(3)16-14(18)7-6-12(2)15;;/h11-13H,4-10,15H2,1-3H3,(H,16,18);2*1H |
| InChIKey | SODPBHRDXWPVRO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |