C18H26N4O — CID 120565817
4-amino-N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]pentanamide (PubChem CID 120565817) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-amino-N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]pentanamide.
| Compound Name | 4-amino-N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]pentanamide |
|---|---|
| PubChem CID | 120565817 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-amino-N-[1-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]pentanamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(C)NC(=O)CCC(C)N)cc2)n1 |
| InChI | InChI=1S/C18H26N4O/c1-12(19)5-10-18(23)20-15(4)16-6-8-17(9-7-16)22-14(3)11-13(2)21-22/h6-9,11-12,15H,5,10,19H2,1-4H3,(H,20,23) |
| InChIKey | PWBYUVBJAWECDU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |